![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Recreating an early multi quire coptic style binding.pdf | 06-Jun-2009 21:23 | 4.9M | |
| How to sew a book block .pdf | 31-Oct-2009 22:42 | 13M | |
| How to bind a basic book block on bands.pdf | 08-Nov-2009 20:57 | 3.6M | |
| Working with gold leaf.pdf | 18-Jan-2011 20:14 | 6.5M | |
| The structure of a Byzantine codice.pdf | 18-Jan-2011 20:15 | 2.2M | |
| Bookbinding a brief history with photos.pdf | 03-Apr-2011 07:50 | 2.2M | |
| Recreating a Nag Hammadi codex (4th century).pdf | 07-Apr-2011 08:48 | 2.0M | |
| book plough in use 1568.pdf | 27-Feb-2012 17:12 | 624K | |
| girdle books.pdf | 05-Mar-2012 14:02 | 9.1M | |
| How to bind a book - quick notes.pdf | 07-Mar-2012 14:49 | 85K | |
| medieval book coverings for transport overview.pdf | 15-Aug-2012 11:16 | 91K | |
| Chemise bindings.pdf | 06-Oct-2012 20:53 | 606K | |
| Coptic binding.pdf | 18-Jan-2013 21:24 | 164K | |
| Book Clasp research/ | 18-Jan-2013 21:25 | - | |
| Coptic binding how to - 2 needles.pdf | 23-Jan-2013 17:36 | 1.5M | |
| Coptic binding by Isabell Winter.pdf | 08-Mar-2013 13:11 | 276K | |